METHYLMALVALATE structure
|
Common Name | METHYLMALVALATE | ||
|---|---|---|---|---|
| CAS Number | 5026-66-4 | Molecular Weight | 294.47200 | |
| Density | 0.922g/cm3 | Boiling Point | 369.8ºC at 760mmHg | |
| Molecular Formula | C19H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 99.4ºC | |
| Name | methyl 7-(2-octylcyclopropen-1-yl)heptanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.922g/cm3 |
|---|---|
| Boiling Point | 369.8ºC at 760mmHg |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.47200 |
| Flash Point | 99.4ºC |
| Exact Mass | 294.25600 |
| PSA | 26.30000 |
| LogP | 5.95090 |
| InChIKey | GYLXZHKHPYLEIF-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC1=C(CCCCCCC(=O)OC)C1 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Methyl-malvat |
| 1-Cyclopropene-1-heptanoic acid,2-octyl-,methyl ester |
| Methylmalvalat |
| Methyl malvalate |
| methyl ester of malvalic acid |
| Malvalinsaeure-methylester |
| Methyl 2-octylcyclopropene-1-heptanoate |
| Malvalic acid methyl ester |