malvalic acid structure
|
Common Name | malvalic acid | ||
|---|---|---|---|---|
| CAS Number | 503-05-9 | Molecular Weight | 280.44500 | |
| Density | 0.954g/cm3 | Boiling Point | 404.9ºC at 760mmHg | |
| Molecular Formula | C18H32O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.6ºC | |
| Name | malvalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.954g/cm3 |
|---|---|
| Boiling Point | 404.9ºC at 760mmHg |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.44500 |
| Flash Point | 301.6ºC |
| Exact Mass | 280.24000 |
| PSA | 37.30000 |
| LogP | 5.86250 |
| Index of Refraction | 1.487 |
| InChIKey | HPSSZFFAYWBIPY-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC1=C(CCCCCCC(=O)O)C1 |
| HS Code | 2916209090 |
|---|
|
~%
malvalic acid CAS#:503-05-9 |
| Literature: Baird, Mark S.; Dale, Cynthia M.; Lytollis, William; Simpson, Michael J. Tetrahedron Letters, 1992 , vol. 33, # 11 p. 1521 - 1522 |
|
~%
malvalic acid CAS#:503-05-9 |
| Literature: Baird, Mark S.; Dale, Cynthia M.; Lytollis, William; Simpson, Michael J. Tetrahedron Letters, 1992 , vol. 33, # 11 p. 1521 - 1522 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Malvalsaeure |
| 7-(2-octylcyclopropen-1-yl)heptanoic acid |
| 8,9-methylene-8Z-heptadecenoic acid |
| 2-Octyl-1-cyclopropene-1-heptanoic acid |
| Malvic acid |
| 8,9-Methylen-8-heptadecensaeure |
| MALVALIC ACID |