(2-chloro-4-nitrophenyl)-(4-chlorophenyl)methanone structure
|
Common Name | (2-chloro-4-nitrophenyl)-(4-chlorophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 50274-64-1 | Molecular Weight | 296.10600 | |
| Density | 1.456g/cm3 | Boiling Point | 446ºC at 760 mmHg | |
| Molecular Formula | C13H7Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.6ºC | |
| Name | (2-chloro-4-nitrophenyl)-(4-chlorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 446ºC at 760 mmHg |
| Molecular Formula | C13H7Cl2NO3 |
| Molecular Weight | 296.10600 |
| Flash Point | 223.6ºC |
| Exact Mass | 294.98000 |
| PSA | 62.89000 |
| LogP | 4.65580 |
| Index of Refraction | 1.63 |
| InChIKey | FNWMOVINSBBOQA-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccc([N+](=O)[O-])cc1Cl |
| HS Code | 2914700090 |
|---|
|
~83%
(2-chloro-4-nit... CAS#:50274-64-1 |
| Literature: Meiji Seika Kaisha, Ltd.; NIPPON KAYAKU CO., LTD. Patent: EP1780202 A1, 2007 ; |
|
~50%
(2-chloro-4-nit... CAS#:50274-64-1 |
| Literature: American Cyanamid Company Patent: US3988300 A1, 1976 ; |
|
~84%
(2-chloro-4-nit... CAS#:50274-64-1 |
| Literature: Carroll; Miller; Mylari; Chappel; Howes Jr.; Lynch; Gupta; Rash; Koch Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 96 - 100 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,4'-dichloro-4-nitrodiphenylmethanone |
| 2,4'-dichloro-4-nitrobenzophenone |
| 4-Chlorophenyl 2-chloro-4-nitrophenyl ketone |