11-[(2R,3S)-3-pentyloxiran-2-yl]undec-9-enoic acid structure
|
Common Name | 11-[(2R,3S)-3-pentyloxiran-2-yl]undec-9-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 503-07-1 | Molecular Weight | 296.44500 | |
| Density | 0.969g/cm3 | Boiling Point | 395.8ºC at 760 mmHg | |
| Molecular Formula | C18H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130ºC | |
| Name | (+)-vernolic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.969g/cm3 |
|---|---|
| Boiling Point | 395.8ºC at 760 mmHg |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.44500 |
| Flash Point | 130ºC |
| Exact Mass | 296.23500 |
| PSA | 49.83000 |
| LogP | 5.09570 |
| Vapour Pressure | 2.29E-07mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | CCPPLLJZDQAOHD-GJGKEFFFSA-N |
| SMILES | CCCCCC1OC1CC=CCCCCCCCC(=O)O |
| HS Code | 2918990090 |
|---|
|
~%
11-[(2R,3S)-3-p... CAS#:503-07-1 |
| Literature: Falck; Reddy; Haines, Donovan C.; Reddy, Komandla Malla; Krishna; Graham, Sandra; Murry, Barbara; Peterson, Julian A. Tetrahedron Letters, 2001 , vol. 42, # 25 p. 4131 - 4133 |
|
~%
11-[(2R,3S)-3-p... CAS#:503-07-1 |
| Literature: Falck; Reddy; Haines, Donovan C.; Reddy, Komandla Malla; Krishna; Graham, Sandra; Murry, Barbara; Peterson, Julian A. Tetrahedron Letters, 2001 , vol. 42, # 25 p. 4131 - 4133 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| cis-Vaccenic acid |
| (9Z)-11-[(2S,3R)-3-Pentyl-2-oxiranyl]-9-undecenoic acid |
| cis-11-tetradecenal |
| 11Z-octadecenoic acid |
| tetradec-11c-enal |
| cis-12,13-epoxyoctadeca-cis-9-enoic acid |
| asclepic acid |