phenylmethoxy-di(propan-2-yl)silane structure
|
Common Name | phenylmethoxy-di(propan-2-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 503071-46-3 | Molecular Weight | 222.39900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenylmethoxy-di(propan-2-yl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H22OSi |
|---|---|
| Molecular Weight | 222.39900 |
| Exact Mass | 222.14400 |
| PSA | 9.23000 |
| LogP | 3.74700 |
| InChIKey | SFZJFCZUMYRPGS-UHFFFAOYSA-N |
| SMILES | CC(C)[SiH](OCc1ccccc1)C(C)C |
|
~73%
phenylmethoxy-d... CAS#:503071-46-3 |
| Literature: Lee, Sunggi; Lee, Hyelee; Tan, Kian L. Journal of the American Chemical Society, 2013 , vol. 135, # 50 p. 18778 - 18781 |
| benzyloxydiisopropylsilane |