Diisopropyl Chlorosilane structure
|
Common Name | Diisopropyl Chlorosilane | ||
|---|---|---|---|---|
| CAS Number | 2227-29-4 | Molecular Weight | 150.722 | |
| Density | 0.883 g/mL at 25 °C(lit.) | Boiling Point | 134.2±9.0 °C at 760 mmHg | |
| Molecular Formula | C6H15ClSi | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 22.2±0.0 °C | |
| Symbol |
GHS02, GHS05 |
Signal Word | Danger | |
| Name | chloro-di(propan-2-yl)silicon |
|---|---|
| Synonym | More Synonyms |
| Density | 0.883 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 134.2±9.0 °C at 760 mmHg |
| Molecular Formula | C6H15ClSi |
| Molecular Weight | 150.722 |
| Flash Point | 22.2±0.0 °C |
| Exact Mass | 150.063156 |
| LogP | 4.52 |
| Vapour Pressure | 10.1±0.2 mmHg at 25°C |
| Index of Refraction | n20/D 1.429(lit.) |
| InChIKey | IGSUJBNDAWQLST-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](Cl)C(C)C |
| Symbol |
GHS02, GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H226-H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R10 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 2986 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 3.1 |
| HS Code | 2931900090 |
|
~45%
Diisopropyl Chl... CAS#:2227-29-4 |
| Literature: Kawakami, Yoshiteru; Sakuma, Yoshinobu; Wakuda, Takashi; Nakai, Tatsuya; Shirasaka, Masayoshi; Kabe, Yoshio Organometallics, 2010 , vol. 29, # 15 p. 3281 - 3288 |
|
~%
Diisopropyl Chl... CAS#:2227-29-4 |
| Literature: Journal of the American Chemical Society, , vol. 114, # 6 p. 2121 - 2128 |
|
~%
Diisopropyl Chl... CAS#:2227-29-4 |
| Literature: Bulletin de la Societe Chimique de France, , p. 1423 - 1427 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| ZLD0432 |
| Silane,chlorobis(1-methylethyl) |
| Silane, chlorodiisopropyl- |
| Diisopropylchlorosilane |
| chlorodi(isopropyl)silane |
| Silane,chloro(diisopropyl) |
| MFCD00054896 |
| Chloro(diisopropyl)silane |
| ClSi(i-Pr)2H |
| Silane, chlorobis(1-methylethyl)- |
| (i-Pr)2SiHCl |
| Chlorodiisopropylsilane |
| ClSiH(i-Pr-)2 |
| SiClH(i-Pr)2 |
| Silane, chloro(diisopropyl)- |
| Diisopropyl Chlorosilane |