tris(4-phenylphenyl)-sulfanylidene-λ5-phosphane structure
|
Common Name | tris(4-phenylphenyl)-sulfanylidene-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 5032-61-1 | Molecular Weight | 522.63800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H27PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tris(4-phenylphenyl)-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C36H27PS |
|---|---|
| Molecular Weight | 522.63800 |
| Exact Mass | 522.15700 |
| PSA | 41.90000 |
| LogP | 9.09400 |
| InChIKey | GFKSGLJKCRHILY-UHFFFAOYSA-N |
| SMILES | S=P(c1ccc(-c2ccccc2)cc1)(c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2930909090 |
|---|
|
~%
tris(4-phenylph... CAS#:5032-61-1 |
| Literature: Worrall Journal of the American Chemical Society, 1930 , vol. 52, p. 2933,2935,2936 |
|
~%
tris(4-phenylph... CAS#:5032-61-1 |
| Literature: Worrall Journal of the American Chemical Society, 1930 , vol. 52, p. 2933,2935,2936 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tris-biphenyl-4-yl-phosphine sulfide |
| Tris-biphenyl-4-yl-phosphinsulfid |