5-(4-Chlorobutyryl)-6-methyl-5H-1,3-dioxolo[4,5-f]indole-7-acetic acid structure
|
Common Name | 5-(4-Chlorobutyryl)-6-methyl-5H-1,3-dioxolo[4,5-f]indole-7-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 50332-11-1 | Molecular Weight | 337.75500 | |
| Density | 1.47g/cm3 | Boiling Point | 533.3ºC at 760 mmHg | |
| Molecular Formula | C16H16ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.3ºC | |
| Name | 2-[5-(4-chlorobutanoyl)-6-methyl-[1,3]dioxolo[4,5-f]indol-7-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 533.3ºC at 760 mmHg |
| Molecular Formula | C16H16ClNO5 |
| Molecular Weight | 337.75500 |
| Flash Point | 276.3ºC |
| Exact Mass | 337.07200 |
| PSA | 77.76000 |
| LogP | 2.96470 |
| Index of Refraction | 1.639 |
| InChIKey | FAGBXKXOWVYBDZ-UHFFFAOYSA-N |
| SMILES | Cc1c(CC(=O)O)c2cc3c(cc2n1C(=O)CCCCl)OCO3 |
| HS Code | 2933990090 |
|---|
|
~%
5-(4-Chlorobuty... CAS#:50332-11-1 |
| Literature: Almirante; Mugnaini; Murmann Bollettino chimico farmaceutico, 1973 , vol. 112, # 2 p. 94 - 103 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Acyl-2-methyl-5,6-methylendioxy-3-indolylysaeure |
| 5H-1,3-Dioxolo(4,5-f)indole-7-acetic acid,5-(4-chloro-1-oxobutyl)-6-methyl |
| 5-(4-Chlorobutyryl)-6-methyl-5H-1,3-dioxolo(4,5-f)indole-7-acetic acid |
| [5-(4-chloro-butyryl)-6-methyl-5H-[1,3]dioxolo[4,5-f]indol-7-yl]-acetic acid |
| 5H-1,3-DIOXOLO(4,5-f)INDOLE-7-ACETIC ACID,5-(4-CHLOROBUTYRYL)-6-METHYL |