4-chloro-8-methyl-2-(2-oxoethylidene)-1H-quinoline-3-carbaldehyde structure
|
Common Name | 4-chloro-8-methyl-2-(2-oxoethylidene)-1H-quinoline-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 503552-61-2 | Molecular Weight | 247.67700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-8-methyl-2-(2-oxoethylidene)-1H-quinoline-3-carbaldehyde |
|---|
| Molecular Formula | C13H10ClNO2 |
|---|---|
| Molecular Weight | 247.67700 |
| Exact Mass | 247.04000 |
| PSA | 49.93000 |
| LogP | 2.20270 |
| InChIKey | UHKQNZYXSYFJHW-AATRIKPKSA-N |
| SMILES | Cc1cccc2c(Cl)c(C=O)c(C=CO)nc12 |
|
~74%
Detail
|
| Literature: Kumar, R. Nandha; Suresh; Dhanabal; Mohan Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2004 , vol. 43, # 4 p. 846 - 851 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |