2-Amino-3,4,5-trichlorobenzoic acid structure
|
Common Name | 2-Amino-3,4,5-trichlorobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 50419-72-2 | Molecular Weight | 240.47100 | |
| Density | 1.716g/cm3 | Boiling Point | 383.9ºC at 760 mmHg | |
| Molecular Formula | C7H4Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186ºC | |
| Name | 2-Amino-3,4,5-trichlorobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.716g/cm3 |
|---|---|
| Boiling Point | 383.9ºC at 760 mmHg |
| Molecular Formula | C7H4Cl3NO2 |
| Molecular Weight | 240.47100 |
| Flash Point | 186ºC |
| Exact Mass | 238.93100 |
| PSA | 63.32000 |
| LogP | 3.50840 |
| Index of Refraction | 1.666 |
| InChIKey | BKLCGTIBUBSYTR-UHFFFAOYSA-N |
| SMILES | Nc1c(C(=O)O)cc(Cl)c(Cl)c1Cl |
| HS Code | 2922499990 |
|---|
|
~%
Detail
|
| Literature: I.G. Farbenind. Patent: DE528115 , 1928 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 17, p. 474 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-amino-3,4,5-trichloro-benzoic acid |
| 2-AMINO-3,4,5-TRICHLOROBENZOICnACID |
| 2-Amino-3,4,5-trichlor-benzoesaeure |
| Benzoicacid,2-amino-3,4,5-trichloro |