4-Amino-2,6-diphenylphenol structure
|
Common Name | 4-Amino-2,6-diphenylphenol | ||
|---|---|---|---|---|
| CAS Number | 50432-01-4 | Molecular Weight | 261.31800 | |
| Density | 1.183g/cm3 | Boiling Point | 463.5ºC at 760 mmHg | |
| Molecular Formula | C18H15NO | Melting Point | 148-150 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 234.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Amino-2,6-diphenylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 463.5ºC at 760 mmHg |
| Melting Point | 148-150 °C(lit.) |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.31800 |
| Flash Point | 234.1ºC |
| Exact Mass | 261.11500 |
| PSA | 46.25000 |
| LogP | 4.88960 |
| Index of Refraction | 1.66 |
| InChIKey | YCOUFOVMXBWYIX-UHFFFAOYSA-N |
| SMILES | Nc1cc(-c2ccccc2)c(O)c(-c2ccccc2)c1 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922199090 |
|
~%
4-Amino-2,6-dip... CAS#:50432-01-4 |
| Literature: Alisi, Maria Alessandra; Brufani, Mario; Cazzolla, Nicola; Ceccacci, Francesca; Dragone, Patrizia; Felici, Marco; Furlotti, Guido; Garofalo, Barbara; La Bella, Angela; Lanzalunga, Osvaldo; Leonelli, Francesca; Marini Bettolo, Rinaldo; Maugeri, Caterina; Migneco, Luisa Maria; Russo, Vincenzo Tetrahedron, 2012 , vol. 68, # 49 p. 10180 - 10187 |
|
~85%
4-Amino-2,6-dip... CAS#:50432-01-4 |
| Literature: Kessler, Manfred A.; Wolfbeis, Otto S. Synthesis, 1988 , # 8 p. 635 - 636 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Equilibrium study of biphenyl-2-ol by infrared spectroscopy.
J. Chem. Soc., Perkin Trans. II 14 , 1663-1665, (1976)
|
| MFCD00034070 |
| 5'-Amino-[1,1':3',1''-terphenyl]-2'-ol |
| 4-AMINO-2,6-DIPHENYLPHENOL |
| 5'-Amino-2'-hydroxy-m-terphenyl |