WAY-310880 structure
|
Common Name | WAY-310880 | ||
|---|---|---|---|---|
| CAS Number | 505051-15-0 | Molecular Weight | 459.56 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 646.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C23H29N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344.6±34.3 °C | |
Use of WAY-310880altering the lifespan of a eukaryotic organism |
| Name | WAY-310880 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 646.1±65.0 °C at 760 mmHg |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.56 |
| Flash Point | 344.6±34.3 °C |
| Exact Mass | 459.182800 |
| LogP | 3.50 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | XSUQMLJANPGLHP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCN(C(=O)CN(c2cccc(C)c2)S(=O)(=O)c2ccc(C)cc2)CC1 |
| 4-{2-[(Toluene-4-sulfonyl)-m-tolyl-amino]-acetyl}-piperazine-1-carboxylic acid ethyl ester |
| 1-Piperazinecarboxylic acid, 4-[2-[(3-methylphenyl)[(4-methylphenyl)sulfonyl]amino]acetyl]-, ethyl ester |
| Ethyl 4-{N-(3-methylphenyl)-N-[(4-methylphenyl)sulfonyl]glycyl}-1-piperazinecarboxylate |