1,2,3-Propanetriol,1,3-dimethanesulfonate structure
|
Common Name | 1,2,3-Propanetriol,1,3-dimethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 5055-06-1 | Molecular Weight | 248.27500 | |
| Density | 1.516g/cm3 | Boiling Point | 545ºC at 760mmHg | |
| Molecular Formula | C5H12O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.4ºC | |
| Name | (2-hydroxy-3-methylsulfonyloxypropyl) methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 545ºC at 760mmHg |
| Molecular Formula | C5H12O7S2 |
| Molecular Weight | 248.27500 |
| Flash Point | 283.4ºC |
| Exact Mass | 248.00200 |
| PSA | 123.73000 |
| LogP | 0.46130 |
| Index of Refraction | 1.495 |
| InChIKey | IACVNURSTUDTFC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCC(O)COS(C)(=O)=O |
|
~%
1,2,3-Propanetr... CAS#:5055-06-1 |
| Literature: Feit; Nielsen Journal of medicinal chemistry, 1966 , vol. 9, # 3 p. 416 - 417 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Glycerol-1,3-bismethansulfonat |
| 1,2,3-Propanetriol,1,3-dimethanesulfonate |
| 2-hydroxypropane-1,3-diyl dimethanesulfonate |