Glycerol 1,3-dimethacrylate structure
|
Common Name | Glycerol 1,3-dimethacrylate | ||
|---|---|---|---|---|
| CAS Number | 1830-78-0 | Molecular Weight | 228.242 | |
| Density | 1.114±0.06 g/cm3 | Boiling Point | 317.2±9.0 °C at 760 mmHg | |
| Molecular Formula | C11H16O5 | Melting Point | -33ºC | |
| MSDS | Chinese | Flash Point | 114.6±12.2 °C | |
| Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.114±0.06 g/cm3 |
|---|---|
| Boiling Point | 317.2±9.0 °C at 760 mmHg |
| Melting Point | -33ºC |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.242 |
| Flash Point | 114.6±12.2 °C |
| Exact Mass | 228.099777 |
| PSA | 72.83000 |
| LogP | 1.33 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | OQHMGFSAURFQAF-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)C(=C)C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | 3077.0 |
| WGK Germany | 1.0 |
| Hazard Class | 9.0 |
| HS Code | 2916190090 |
|
~%
Glycerol 1,3-di... CAS#:1830-78-0 |
| Literature: Green Chemistry, , vol. 14, # 8 p. 2346 - 2352 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 1,2,3-Propanetriol, 1,3-di(2-methyl-2-propenoate) |
| glyceryl dimethacrylate |
| Glycerol Dimethacrylate |
| Bis(methacryloyloxy)propanol |
| Glycerol dimethacrylate,mixture of isomers |
| 2-Hydroxypropane-1,3-diyl bis(2-methylacrylate) |
| 2-Hydroxy-1,3-propanediyl bis(2-methylacrylate) |
| glycerine dimethacrylate |
| glycerol dimethylacrylate |
| glycerol-1,3-dimethacrylate |
| 2-Propenoic acid, 2-methyl-, 2-hydroxy-1,3-propanediyl ester |
| 2-hydroxy-1,3-propanediyl bismethacrylate |
| EINECS 217-388-4 |