Di-p-anisoyl-L-tartaric acid structure
|
Common Name | Di-p-anisoyl-L-tartaric acid | ||
|---|---|---|---|---|
| CAS Number | 50583-51-2 | Molecular Weight | 418.351 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 681.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H18O10 | Melting Point | 193-195°C | |
| MSDS | N/A | Flash Point | 241.6±25.0 °C | |
| Name | (-)-Bis(4-methoxybenzoyl)-L-tartaric Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 681.6±55.0 °C at 760 mmHg |
| Melting Point | 193-195°C |
| Molecular Formula | C20H18O10 |
| Molecular Weight | 418.351 |
| Flash Point | 241.6±25.0 °C |
| Exact Mass | 418.089996 |
| PSA | 145.66000 |
| LogP | 5.97 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | KWWCVCFQHGKOMI-HZPDHXFCSA-N |
| SMILES | COc1ccc(C(=O)OC(C(=O)O)C(OC(=O)c2ccc(OC)cc2)C(=O)O)cc1 |
| Hazard Codes | T+,C,T |
|---|---|
| Risk Phrases | R14:Reacts violently with water. R26:Very Toxic by inhalation. R34:Causes burns. R37:Irritating to the respiratory system. |
| Safety Phrases | S26-S36/37/39-S38-S45 |
| RIDADR | UN 2418 2.3 |
| WGK Germany | 3 |
| RTECS | WT4800000 |
| Hazard Class | 2.3 |
| HS Code | 2918990090 |
|
~0%
Di-p-anisoyl-L-... CAS#:50583-51-2 |
| Literature: Aventis Pharmaceuticals, Inc.; Hoechst Marion Roussel Deutschland GmbH Patent: EP1734037 A2, 2006 ; Location in patent: Page/Page column 9; 41 ; |
|
~0%
Di-p-anisoyl-L-... CAS#:50583-51-2 |
| Literature: Aventis Pharmaceuticals, Inc.; Hoechst Marion Roussel Deutschland GmbH Patent: EP1734037 A2, 2006 ; Location in patent: Page/Page column 11; 41-42 ; |
|
~%
Di-p-anisoyl-L-... CAS#:50583-51-2 |
| Literature: Aventis Pharmaceuticals, Inc.; Hoechst Marion Roussel Deutschland GmbH Patent: EP1734037 A2, 2006 ; Location in patent: Page/Page column 33-37 ; |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD02682986 |
| (+)-DIBENZOYL-P-METHOXY-D-TARTARIC ACID |
| (2S,3S)-2,3-Bis[(4-methoxybenzoyl)oxy]succinic acid |
| (-)-Di-p-anisoyl-L-tartaric Acid |
| 2,3-bis[(4-methoxybenzoyl)oxy]butanedioic acid |
| 2,3-Bis[(4-methoxybenzoyl)oxy]succinic acid |
| (2S,3S)-2,3-Bis{[(4-methoxyphenyl)carbonyl]oxy}butanedioic acid |
| (2R,3R)-2,3-Bis((4-methoxybenzoyl)oxy)succinic acid |
| Di-p-anisoyl-L-tartaric acid |