2,3-dichloro-5-(trifluoromethyl)aniline structure
|
Common Name | 2,3-dichloro-5-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 50594-81-5 | Molecular Weight | 230.01500 | |
| Density | 1.542g/cm3 | Boiling Point | 238.1ºC at 760 mmHg | |
| Molecular Formula | C7H4Cl2F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 97.8ºC | |
| Name | 2,3-dichloro-5-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.542g/cm3 |
|---|---|
| Boiling Point | 238.1ºC at 760 mmHg |
| Molecular Formula | C7H4Cl2F3N |
| Molecular Weight | 230.01500 |
| Flash Point | 97.8ºC |
| Exact Mass | 228.96700 |
| PSA | 26.02000 |
| LogP | 4.17560 |
| Index of Refraction | 1.518 |
| InChIKey | QVGXDVUFEAAYHW-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(F)(F)F)cc(Cl)c1Cl |
|
~75%
2,3-dichloro-5-... CAS#:50594-81-5 |
| Literature: Rohm and Haas Company Patent: US4419122 A1, 1983 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 3-Amino-4,5-dichloro-trifluoromethylbenzene |