1,2-Dichloro-3-nitro-5-(trifluoromethyl)benzene structure
|
Common Name | 1,2-Dichloro-3-nitro-5-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 657-02-3 | Molecular Weight | 259.997 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 239.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H2Cl2F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 98.6±25.9 °C | |
| Name | 3,4-Dichloro-5-Nitrobenzotrifluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 239.3±35.0 °C at 760 mmHg |
| Molecular Formula | C7H2Cl2F3NO2 |
| Molecular Weight | 259.997 |
| Flash Point | 98.6±25.9 °C |
| Exact Mass | 258.941467 |
| PSA | 45.82000 |
| LogP | 3.84 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.511 |
| InChIKey | FZHCKUHPOZBPHB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc(Cl)c1Cl |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 20/21/22 |
| Safety Phrases | 36/37/39-45 |
| HS Code | 2904909090 |
|
~18%
1,2-Dichloro-3-... CAS#:657-02-3 |
| Literature: Rohm and Haas Company Patent: US4046798 A1, 1977 ; |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,2-Dichloro-3-nitro-5-(trifluoromethyl)benzene |
| Benzene, 1,2-dichloro-3-nitro-5-(trifluoromethyl)- |
| 3-Nitro-4,5-dichlorobenzotrifluoride |