N,N'-(2-Chloro-1,4-phenylene)diacetamide structure
|
Common Name | N,N'-(2-Chloro-1,4-phenylene)diacetamide | ||
|---|---|---|---|---|
| CAS Number | 50610-32-7 | Molecular Weight | 226.660 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 485.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.6±27.3 °C | |
| Name | N,N'-(2-Chloro-1,4-phenylene)diacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 485.8±40.0 °C at 760 mmHg |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.660 |
| Flash Point | 247.6±27.3 °C |
| Exact Mass | 226.050903 |
| PSA | 58.20000 |
| LogP | -0.13 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | WGHROLNIFFZEQJ-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(NC(C)=O)c(Cl)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~%
N,N'-(2-Chloro-... CAS#:50610-32-7 |
| Literature: Wella AG Patent: US3973900 A1, 1976 ; |
|
~%
N,N'-(2-Chloro-... CAS#:50610-32-7 |
| Literature: Adams; Anderson Journal of the American Chemical Society, 1950 , vol. 72, p. 5154,5157 |
|
~%
N,N'-(2-Chloro-... CAS#:50610-32-7 |
| Literature: Kehrmann; Grab Justus Liebigs Annalen der Chemie, 1898 , vol. 303, p. 10 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-(2-Chloro-1,4-phenylene)diacetamide |
| N-(4-acetamido-3-chlorophenyl)acetamide |
| Acetamide, N,N'-(2-chloro-1,4-phenylene)bis- |