N,N,7-trimethyl-1,2,4-benzotriazin-3-amine 1-oxide
Modify Date: 2024-03-01 18:56:11
N,N,7-trimethyl-1,2,4-benzotriazin-3-amine 1-oxide structure
|
Common Name | N,N,7-trimethyl-1,2,4-benzotriazin-3-amine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 50632-92-3 | Molecular Weight | 204.22800 | |
| Density | 1.25g/cm3 | Boiling Point | 371.5ºC at 760 mmHg | |
| Molecular Formula | C10H12N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.5ºC | |
| Name | N,N,7-trimethyl-1-oxido-1,2,4-benzotriazin-1-ium-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 371.5ºC at 760 mmHg |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.22800 |
| Flash Point | 178.5ºC |
| Exact Mass | 204.10100 |
| PSA | 54.48000 |
| LogP | 1.43270 |
| Index of Refraction | 1.631 |
| InChIKey | JXTRWBHIQTVXTI-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(N(C)C)n[n+]([O-])c2c1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| N,N,7-Trimethyl-1,2,4-benzotriazin-3-amine 1-oxide |
| EINECS 256-667-5 |
| 1,2,4-Benzotriazin-3-amine,N,N,7-trimethyl-,1-oxide |