7-BROMO-5-METHYL-1,2,4-BENZOTRIAZIN-3-AMINE-1-OXIDE structure
|
Common Name | 7-BROMO-5-METHYL-1,2,4-BENZOTRIAZIN-3-AMINE-1-OXIDE | ||
|---|---|---|---|---|
| CAS Number | 677297-87-9 | Molecular Weight | 255.07100 | |
| Density | 1.95g/cm3 | Boiling Point | 485.6ºC at 760 mmHg | |
| Molecular Formula | C8H7BrN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.5ºC | |
| Name | 7-bromo-5-methyl-1-oxido-1,2,4-benzotriazin-1-ium-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.95g/cm3 |
|---|---|
| Boiling Point | 485.6ºC at 760 mmHg |
| Molecular Formula | C8H7BrN4O |
| Molecular Weight | 255.07100 |
| Flash Point | 247.5ºC |
| Exact Mass | 253.98000 |
| PSA | 77.26000 |
| LogP | 2.29260 |
| Index of Refraction | 1.776 |
| InChIKey | VGFWCCQZFGMAJU-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)cc2c1nc(N)n[n+]2[O-] |
|
~36%
7-BROMO-5-METHY... CAS#:677297-87-9 |
| Literature: US2005/245524 A1, ; Page/Page column 27 ; US 20050245524 A1 |
|
~%
7-BROMO-5-METHY... CAS#:677297-87-9 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 3 p. 602 - 608 Bioorganic and Medicinal Chemistry Letters, , vol. 16, # 21 p. 5546 - 5550 |
| 1,2,4-Benzotriazin-3-amine,7-bromo-5-methyl-,1-oxide |
| 7-Bromo-5-methyl-1,2,4-benzotriazin-3-amine-1-oxide |