Propionamide, N,N-bis(2-chloroethyl)- 2-(2, 2-dichloroacetamido)-3-methoxy- structure
|
Common Name | Propionamide, N,N-bis(2-chloroethyl)- 2-(2, 2-dichloroacetamido)-3-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 5064-13-1 | Molecular Weight | 354.05800 | |
| Density | 1.379g/cm3 | Boiling Point | 504.3ºC at 760 mmHg | |
| Molecular Formula | C10H16Cl4N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.8ºC | |
| Name | Propionamide, N,N-bis(2-chloroethyl)- 2-(2,2-dichloroacetamido)-3-methoxy |
|---|---|
| Synonym | More Synonyms |
| Density | 1.379g/cm3 |
|---|---|
| Boiling Point | 504.3ºC at 760 mmHg |
| Molecular Formula | C10H16Cl4N2O3 |
| Molecular Weight | 354.05800 |
| Flash Point | 258.8ºC |
| Exact Mass | 351.99200 |
| PSA | 58.64000 |
| LogP | 1.61840 |
| Index of Refraction | 1.51 |
| InChIKey | XBUBUBLJUGSCBM-UHFFFAOYSA-N |
| SMILES | COCC(NC(=O)C(Cl)Cl)C(=O)N(CCCl)CCCl |
| HS Code | 2924199090 |
|---|
|
~%
Propionamide, N... CAS#:5064-13-1 |
| Literature: Levi,I. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 715 - 718 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Dichloracetamido-thiazol-4-on |