Alanine,N-(dichloroacetyl)-3-methoxy-, DL- (8CI) structure
|
Common Name | Alanine,N-(dichloroacetyl)-3-methoxy-, DL- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 3183-36-6 | Molecular Weight | 230.04600 | |
| Density | 1.455g/cm3 | Boiling Point | 420.8ºC at 760 mmHg | |
| Molecular Formula | C6H9Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.3ºC | |
| Name | 2-[(2,2-dichloroacetyl)amino]-3-methoxypropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.455g/cm3 |
|---|---|
| Boiling Point | 420.8ºC at 760 mmHg |
| Molecular Formula | C6H9Cl2NO4 |
| Molecular Weight | 230.04600 |
| Flash Point | 208.3ºC |
| Exact Mass | 228.99100 |
| PSA | 75.63000 |
| LogP | 0.39680 |
| Index of Refraction | 1.498 |
| InChIKey | SUCZIBHMRATEOU-UHFFFAOYSA-N |
| SMILES | COCC(NC(=O)C(Cl)Cl)C(=O)O |
|
~%
Alanine,N-(dich... CAS#:3183-36-6 |
| Literature: Levi,I. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 715 - 718 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N-Dichloracetyl-O-methyl-DL-serin |