6-hexylsulfanyl-5H-purin-2-amine structure
|
Common Name | 6-hexylsulfanyl-5H-purin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 5069-65-8 | Molecular Weight | 251.35100 | |
| Density | 1.38g/cm3 | Boiling Point | 396.5ºC at 760 mmHg | |
| Molecular Formula | C11H17N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.6ºC | |
| Name | 6-hexylsulfanyl-7H-purin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 396.5ºC at 760 mmHg |
| Molecular Formula | C11H17N5S |
| Molecular Weight | 251.35100 |
| Flash Point | 193.6ºC |
| Exact Mass | 251.12000 |
| PSA | 105.78000 |
| LogP | 3.18870 |
| Index of Refraction | 1.694 |
| InChIKey | HHVNOIXEDWFLKN-UHFFFAOYSA-N |
| SMILES | CCCCCCSc1nc(N)nc2nc[nH]c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Amino-6-hexylthiopurin |
| 6-hexylsulfanyl-7(9)H-purin-2-ylamine |