6-[(2-methylphenyl)methylsulfanyl]-7H-purine structure
|
Common Name | 6-[(2-methylphenyl)methylsulfanyl]-7H-purine | ||
|---|---|---|---|---|
| CAS Number | 5069-73-8 | Molecular Weight | 256.32600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[(2-methylphenyl)methylsulfanyl]-7H-purine |
|---|
| Molecular Formula | C13H12N4S |
|---|---|
| Molecular Weight | 256.32600 |
| Exact Mass | 256.07800 |
| PSA | 79.76000 |
| LogP | 2.95360 |
| InChIKey | ZSISWONFONJBBH-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1CSc1ncnc2nc[nH]c12 |
| HS Code | 2933990090 |
|---|
|
~35%
6-[(2-methylphe... CAS#:5069-73-8 |
| Literature: Pathak, Ashish K.; Pathak, Vibha; Seitz, Lainne E.; Suling, William J.; Reynolds, Robert C. Journal of Medicinal Chemistry, 2004 , vol. 47, # 1 p. 273 - 276 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |