3,6-Diamino-9-ethylcarbazole structure
|
Common Name | 3,6-Diamino-9-ethylcarbazole | ||
|---|---|---|---|---|
| CAS Number | 50717-02-7 | Molecular Weight | 225.28900 | |
| Density | 1.28g/cm3 | Boiling Point | 494.1ºC at 760 mmHg | |
| Molecular Formula | C14H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.6ºC | |
| Name | 9-ethylcarbazole-3,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 494.1ºC at 760 mmHg |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.28900 |
| Flash Point | 252.6ºC |
| Exact Mass | 225.12700 |
| PSA | 56.97000 |
| LogP | 4.14120 |
| Index of Refraction | 1.686 |
| InChIKey | VYQYKCAZJQOVJO-UHFFFAOYSA-N |
| SMILES | CCn1c2ccc(N)cc2c2cc(N)ccc21 |
| HS Code | 2933990090 |
|---|
|
~%
3,6-Diamino-9-e... CAS#:50717-02-7 |
| Literature: Is, Ozde Deniz; Koyuncu, Fatma Baycan; Koyuncu, Sermet; Ozdemir, Eyup Polymer, 2010 , vol. 51, # 8 p. 1663 - 1669 |
|
~%
3,6-Diamino-9-e... CAS#:50717-02-7 |
| Literature: Is, Ozde Deniz; Koyuncu, Fatma Baycan; Koyuncu, Sermet; Ozdemir, Eyup Polymer, 2010 , vol. 51, # 8 p. 1663 - 1669 |
|
~%
3,6-Diamino-9-e... CAS#:50717-02-7 |
| Literature: Is, Ozde Deniz; Koyuncu, Fatma Baycan; Koyuncu, Sermet; Ozdemir, Eyup Polymer, 2010 , vol. 51, # 8 p. 1663 - 1669 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-Aethyl-carbazol-3,6-diyldiamin |
| 3,6-Diamino-9-ethylcarbazole |
| CARBAZOLE,3,6-DIAMINO-9-ETHYL |
| 9-ethyl-carbazole-3,6-diamine |
| 9H-Carbazole-3,9-ethyl |
| 3,6-Diamino-9-ethylcarbazol |
| N-ethyl-3,6-diaminocarbazole |
| 9-ethyl-carbazole-3,6-diyldiamine |