δ-amyrin structure
|
Common Name | δ-amyrin | ||
|---|---|---|---|---|
| CAS Number | 508-04-3 | Molecular Weight | 426.72 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 491.2±44.0 °C at 760 mmHg | |
| Molecular Formula | C30H50O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.8±20.7 °C | |
Use of δ-amyrinδ-Amyrin is a compound isolated from the bark of Scaevola floribunda[1]. |
| Name | 13(18)-Oleanen-3-ol |
|---|---|
| Synonym | More Synonyms |
| Description | δ-Amyrin is a compound isolated from the bark of Scaevola floribunda[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 491.2±44.0 °C at 760 mmHg |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.72 |
| Flash Point | 217.8±20.7 °C |
| Exact Mass | 426.386169 |
| PSA | 20.23000 |
| LogP | 11.09 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.540 |
| InChIKey | JOCIRBSYAYKMEF-YDPPSCFKSA-N |
| SMILES | CC1(C)CCC2(C)CCC3(C)C(=C2C1)CCC1C2(C)CCC(O)C(C)(C)C2CCC13C |
| Hazard Codes | Xi |
|---|
| (3β)-Olean-13(18)-en-3-ol |
| δ-amyrin |
| (5ξ)-Olean-13(18)-en-3-ol |
| Olean-13(18)-en-3-ol, (3β)- |
| Olean-13(18)-en-3-ol, (5ξ)- |