14-Hydroxy Codeinone
14-Hydroxy Codeinone structure
|
Common Name | 14-Hydroxy Codeinone | ||
|---|---|---|---|---|
| CAS Number | 508-54-3 | Molecular Weight | 313.34800 | |
| Density | 1.433g/cm3 | Boiling Point | 512.176ºC at 760 mmHg | |
| Molecular Formula | C18H19NO4 | Melting Point | 275°C (rough estimate) | |
| MSDS | N/A | Flash Point | 263.555ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
Summary: 14-Hydroxy Codeinone (Chinese name: 羟考酮相关物质A, CAS number: 508-54-3), molecular formula C18H19NO4, molecular weight 313.34800. The melting point is approximately 275°C, boiling point 512.176°C, and density 1.433g/cm³. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 14-Hydroxy Codeinone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.433g/cm3 |
|---|---|
| Boiling Point | 512.176ºC at 760 mmHg |
| Melting Point | 275°C (rough estimate) |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.34800 |
| Flash Point | 263.555ºC |
| Exact Mass | 313.13100 |
| PSA | 59.00000 |
| LogP | 1.35280 |
| Index of Refraction | 1.684 |
| InChIKey | YYCRAERBSFHMPL-XFKAJCMBSA-N |
| SMILES | COc1ccc2c3c1OC1C(=O)C=CC4(O)C(C2)N(C)CCC314 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300 + H310 + H330 |
| Precautionary Statements | Missing Phrase - N15.00950417-P260-P262-P280-P302 + P352 + P310-P304 + P340 + P310 |
| RIDADR | NONH for all modes of transport |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 8 | |
CAS#:115-37-7
CAS#:6703-27-1
CAS#:467-13-0
CAS#:36127-27-2
CAS#:76-57-3![(4R,4aS,7S,7aR,12bS)-9-methoxy-3-methyl-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,7-diol Structure](https://image.chemsrc.com/caspic/206/4829-46-3.png)
CAS#:4829-46-3
CAS#:65012-43-3
CAS#:76-42-6
CAS#:16590-41-3
CAS#:124-90-3
CAS#:5985-56-8![[(4R,4aS,7aR,12bS)-9-methoxy-3-methyl-7-oxo-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-4a-yl] pentanoate structure](https://image.chemsrc.com/caspic/310/1250-84-6.png)
CAS#:1250-84-6
CAS#:7239-97-6![[(4R,4aS,7aR,12bS)-9-methoxy-3-methyl-7-oxo-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-4a-yl] propanoate structure](https://image.chemsrc.com/caspic/216/981-01-1.png)
CAS#:981-01-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-(9b-ethyl-5-methoxy-1,2,3,3a,8,9,9a,9b-octahydro-phenanthro[4,5-bcd]furan-3-yl)-morpholine |
| Morpholine,4-(9bb-ethyl-1,2,3,3ab,8,9,9ab,9b-octahydro-5-methoxyphenanthro[4,5-bcd]furan-3-yl)-(8CI) |
| Oxycodone impurity D |
| Morpholine,4-(9b-ethyl-1,2,3,3a,8,9,9a,9b-octahydro-5-methoxyphenanthro[4,5-bcd]furan-3-yl)-,[3S-(3a,3ab,9ab,9bb)]-(9CI) |
| 14-hydroxy-codeinone |
| Morpholine,4-(9bb-ethyl-1,2,3,3a,8,9,9ab,9b-octahydro-5-methoxyphenanthro[4,5-bcd]furan-3a-yl)-(7CI) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 14-Hydroxy Codeinone? |
| A: LogP of 14-Hydroxy Codeinone is 1.35280. |
| Q: What is the English name of 14-Hydroxy Codeinone? |
| A: The English name of 14-Hydroxy Codeinone is 14-Hydroxy Codeinone. |
| Q: What are the upstream materials of 14-Hydroxy Codeinone? |
| A: Related upstream materials(CAS) of 14-Hydroxy Codeinone: 115-37-7;6703-27-1;467-13-0;36127-27-2;76-57-3;4829-46-3;65012-43-3. |
| Q: What is the molecular formula of 14-Hydroxy Codeinone? |
| A: Molecular formula of 14-Hydroxy Codeinone is C18H19NO4. |
| Q: What is the SMILES notation of 14-Hydroxy Codeinone? |
| A: SMILES notation of 14-Hydroxy Codeinone is COc1ccc2c3c1OC1C(=O)C=CC4(O)C(C2)N(C)CCC314. |
| Q: What is the InChIKey of 14-Hydroxy Codeinone? |
| A: InChIKey of 14-Hydroxy Codeinone is YYCRAERBSFHMPL-XFKAJCMBSA-N. |
| Q: What are the downstream products of 14-Hydroxy Codeinone? |
| A: Related downstream products(CAS) of 14-Hydroxy Codeinone: 76-42-6;4829-46-3;16590-41-3;124-90-3;5985-56-8;1250-84-6;7239-97-6;981-01-1. |
| Q: What is the melting point of 14-Hydroxy Codeinone? |
| A: Melting point of 14-Hydroxy Codeinone is 275°C (rough estimate). |
| Q: What is the CAS number of 14-Hydroxy Codeinone? |
| A: CAS number of 14-Hydroxy Codeinone is 508-54-3. |
| Q: What is the molecular weight of 14-Hydroxy Codeinone? |
| A: Molecular weight of 14-Hydroxy Codeinone is 313.34800. |