Hellebrigenol structure
|
Common Name | Hellebrigenol | ||
|---|---|---|---|---|
| CAS Number | 508-79-2 | Molecular Weight | 418.52300 | |
| Density | N/A | Boiling Point | 635.4±55.0 °C(Predicted) | |
| Molecular Formula | C24H34O6 | Melting Point | 146-153 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of HellebrigenolHellebrigenol is a metabolite of bufadienolides with antitumor activity[1]. |
| Name | hellebrigenol |
|---|---|
| Synonym | More Synonyms |
| Description | Hellebrigenol is a metabolite of bufadienolides with antitumor activity[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Hellebrigenol shows cytotoxicity against HepG2 cells with an IC50 of 56.581 ng/mL[1]. |
| References |
| Boiling Point | 635.4±55.0 °C(Predicted) |
|---|---|
| Melting Point | 146-153 °C |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.52300 |
| Exact Mass | 418.23600 |
| PSA | 111.13000 |
| LogP | 2.32920 |
| InChIKey | ABVKNZHLRVHZSO-XHCIOXAKSA-N |
| SMILES | CC12CCC3C(CCC4(O)CC(O)CCC34CO)C1(O)CCC2c1ccc(=O)oc1 |
| Hazard Codes | Xi |
|---|
| 5-((3S,5S,8R,9S,10R,13R,14S,17R)-3,5,14-Trihydroxy-10-hydroxymethyl-13-methyl-hexadecahydro-cyclopenta[a]phenanthren-17-yl)-pyran-2-one |
| 3β,5,14,19-tetrahydroxy-5β,14β-bufa-20,22-dienolide |
| 3β,5,14,19-Tetrahydroxy-5β,14β-bufa-20,22-dienolid |