6-formyl-2-naphthoic acid structure
|
Common Name | 6-formyl-2-naphthoic acid | ||
|---|---|---|---|---|
| CAS Number | 5084-45-7 | Molecular Weight | 200.19000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-formyl-2-naphthoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8O3 |
|---|---|
| Molecular Weight | 200.19000 |
| Exact Mass | 200.04700 |
| PSA | 54.37000 |
| LogP | 2.35050 |
| InChIKey | SHFLOIUZUDNHFB-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc2cc(C(=O)O)ccc2c1 |
| HS Code | 2918300090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-formyl-6-naphthoic acid |
| 2-formyl-naphthalene-6-carboxylic acid |
| formylnaphthoic acid |
| 6-Formyl-2-naphthoesaeure |