2,6-Naphthalenedicarboxylic acid structure
|
Common Name | 2,6-Naphthalenedicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1141-38-4 | Molecular Weight | 216.189 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 437.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H8O4 | Melting Point | >300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 232.4±19.7 °C | |
| Name | naphthalene-2,6-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 437.3±25.0 °C at 760 mmHg |
| Melting Point | >300 °C(lit.) |
| Molecular Formula | C12H8O4 |
| Molecular Weight | 216.189 |
| Flash Point | 232.4±19.7 °C |
| Exact Mass | 216.042252 |
| PSA | 74.60000 |
| LogP | 2.80 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.708 |
| InChIKey | RXOHFPCZGPKIRD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2cc(C(=O)O)ccc2c1 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Porous metal-organic framework with coordinatively unsaturated Mn(II) sites:sorption properties for various gases.
Inorg. Chem. 45(21) , 8672-6, (2006) A 3D porous metal-organic framework generating 1D channels, [Mn(NDC)(DEF)]n (1), has been prepared from the solvothermal reaction of Mn(II) and 2,6-naphthalenedicarboxylic acid (H2NDC) in diethylforma... |
|
|
Decarboxylative polymerization of 2,6-naphthalenedicarboxylic acid at surfaces.
J. Am. Chem. Soc. 136(27) , 9658-63, (2014) Metal-catalyzed polymerization of 2,6-naphthalenedicarboxylic acid (NDCA) to form poly-2,6-naphthalenes at various surfaces is reported. Polymerizations occur via initial formal dehydrogenation of sel... |
|
|
Distinct differences in self-assembly of aromatic linear dicarboxylic acids.
Langmuir 25(2) , 968-72, (2009) Self-assembly into two-dimensionally ordered supramolecular structures of three aromatic dicarboxylic acids-2,6-naphthalenedicarboxylic acid (NDA), 4,4'-biphenyldicarboxylic acid (BPDA), and 4,4'-stil... |
| EINECS 214-527-0 |
| 2,6-Naphthalenedicarboxylic acid |
| Naphthalene-2,6-dicarboxylic acid |
| MFCD00004105 |