4,5-Dicyano-2-phenylimidazole structure
|
Common Name | 4,5-Dicyano-2-phenylimidazole | ||
|---|---|---|---|---|
| CAS Number | 50847-06-8 | Molecular Weight | 194.19200 | |
| Density | 1.36g/cm3 | Boiling Point | 540.7ºC at 760mmHg | |
| Molecular Formula | C11H6N4 | Melting Point | 192-196ºC(dec) | |
| MSDS | N/A | Flash Point | 164.2ºC | |
| Name | 2-Phenyl-1H-imidazole-4,5-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 540.7ºC at 760mmHg |
| Melting Point | 192-196ºC(dec) |
| Molecular Formula | C11H6N4 |
| Molecular Weight | 194.19200 |
| Flash Point | 164.2ºC |
| Exact Mass | 194.05900 |
| PSA | 76.26000 |
| LogP | 1.82006 |
| Index of Refraction | 1.654 |
| InChIKey | PGSHQANDAMACEF-UHFFFAOYSA-N |
| SMILES | N#Cc1nc(-c2ccccc2)[nH]c1C#N |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933290090 |
|
~67%
4,5-Dicyano-2-p... CAS#:50847-06-8 |
| Literature: Moriya, Osamu; Minamide, Hiroshi; Urata, Yoshikiyo Synthesis, 1984 , # 12 p. 1057 - 1058 |
|
~%
4,5-Dicyano-2-p... CAS#:50847-06-8 |
| Literature: Sadchikova; Mokrushin Russian Chemical Bulletin, 2005 , vol. 54, # 2 p. 354 - 365 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-PHENYL-1H-IMIDAZOLE-4,5-DICARBONITRILE |
| 4,5-Dicyano-2-phenylimidazole |