4-methyl-4-(2-methylpropyl)piperidine-2,6-dione structure
|
Common Name | 4-methyl-4-(2-methylpropyl)piperidine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 50849-39-3 | Molecular Weight | 183.24700 | |
| Density | 0.991g/cm3 | Boiling Point | 304ºC at 760 mmHg | |
| Molecular Formula | C10H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123ºC | |
| Name | 4-methyl-4-(2-methylpropyl)piperidine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 0.991g/cm3 |
|---|---|
| Boiling Point | 304ºC at 760 mmHg |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.24700 |
| Flash Point | 123ºC |
| Exact Mass | 183.12600 |
| PSA | 49.66000 |
| LogP | 1.75130 |
| Index of Refraction | 1.451 |
| InChIKey | CXEDDPDGICQBFN-UHFFFAOYSA-N |
| SMILES | CC(C)CC1(C)CC(=O)NC(=O)C1 |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-Isobutyl-3-methylglutarimide |
| 4-isobutyl-4-methyl-piperidine-2,6-dione |
| Glutarimide,3-isobutyl-3-methyl |