Ethanol,2,2'-[(4-phenoxyphenyl)imino]bis- structure
|
Common Name | Ethanol,2,2'-[(4-phenoxyphenyl)imino]bis- | ||
|---|---|---|---|---|
| CAS Number | 50891-70-8 | Molecular Weight | 273.32700 | |
| Density | 1.209g/cm3 | Boiling Point | 465.5ºC at 760 mmHg | |
| Molecular Formula | C16H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.3ºC | |
| Name | 2-[N-(2-hydroxyethyl)-4-phenoxyanilino]ethanol |
|---|
| Density | 1.209g/cm3 |
|---|---|
| Boiling Point | 465.5ºC at 760 mmHg |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.32700 |
| Flash Point | 235.3ºC |
| Exact Mass | 273.13600 |
| PSA | 52.93000 |
| LogP | 2.26990 |
| Index of Refraction | 1.619 |
| InChIKey | POKACMWIFAASMP-UHFFFAOYSA-N |
| SMILES | OCCN(CCO)c1ccc(Oc2ccccc2)cc1 |
|
~%
Ethanol,2,2'-[(... CAS#:50891-70-8 |
| Literature: Freifelder,M.; Stone,G.R. Journal of Organic Chemistry, 1961 , vol. 26, p. 1477 - 1480 |
|
~%
Ethanol,2,2'-[(... CAS#:50891-70-8 |
| Literature: Everett; Ross Journal of the Chemical Society, 1949 , p. 1972,1974 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |