6-Clhg-8-Et-tpd
Modify Date: 2025-09-21 09:38:08
6-Clhg-8-Et-tpd structure
|
Common Name | 6-Clhg-8-Et-tpd | ||
|---|---|---|---|---|
| CAS Number | 50979-29-8 | Molecular Weight | 433.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9ClHgN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Clhg-8-Et-tpd |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H9ClHgN2O2S |
|---|---|
| Molecular Weight | 433.28 |
| InChIKey | NLCVSSBTAPHZDY-UHFFFAOYSA-M |
| SMILES | CCN1C(=O)C([Hg]Cl)C(=O)N2C=CSC21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 6-Clhg-8-Et-tpd? |
| A: SMILES notation of 6-Clhg-8-Et-tpd is CCN1C(=O)C([Hg]Cl)C(=O)N2C=CSC21. |
| Q: What is the InChIKey of 6-Clhg-8-Et-tpd? |
| A: InChIKey of 6-Clhg-8-Et-tpd is NLCVSSBTAPHZDY-UHFFFAOYSA-M. |
| Q: What is the molecular formula of 6-Clhg-8-Et-tpd? |
| A: Molecular formula of 6-Clhg-8-Et-tpd is C8H9ClHgN2O2S. |
| Q: What is the Chinese name of 50979-29-8? |
| A: Chinese name of 50979-29-8 is 50979-29-8. |
| Q: What is the molecular weight of 6-Clhg-8-Et-tpd? |
| A: Molecular weight of 6-Clhg-8-Et-tpd is 433.28. |
| Q: What is the CAS number of 6-Clhg-8-Et-tpd? |
| A: CAS number of 6-Clhg-8-Et-tpd is 50979-29-8. |
| Q: What is the English name of 6-Clhg-8-Et-tpd? |
| A: The English name of 6-Clhg-8-Et-tpd is 6-Clhg-8-Et-tpd. |