4-(Methylamino)phenol sulfate structure
|
Common Name | 4-(Methylamino)phenol sulfate | ||
|---|---|---|---|---|
| CAS Number | 51-72-9 | Molecular Weight | 221.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H11NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-methyl-4-hydroxyaniline sulfate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H11NO5S |
|---|---|
| Molecular Weight | 221.23100 |
| Exact Mass | 221.03600 |
| PSA | 115.24000 |
| LogP | 1.93490 |
| InChIKey | OHYPPUOVSUINHM-UHFFFAOYSA-N |
| SMILES | CNc1ccc(O)cc1.O=S(=O)(O)O |
| Hazard Codes | Xi |
|---|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 4-methylaminophenol sulfate |
| 4-(N-methylamino)phenol sulfate |
| N-methyl-4-hydroxyanilinium sulfate |
| p-methylaminophenol sulfate |