ethyl 4-(ethoxycarbonylamino)benzoate
Modify Date: 2025-08-21 19:12:09
ethyl 4-(ethoxycarbonylamino)benzoate structure
|
Common Name | ethyl 4-(ethoxycarbonylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 5100-21-0 | Molecular Weight | 237.25200 | |
| Density | 1.187g/cm3 | Boiling Point | 309.4ºC at 760 mmHg | |
| Molecular Formula | C12H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.9ºC | |
| Name | ethyl 4-(ethoxycarbonylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.187g/cm3 |
|---|---|
| Boiling Point | 309.4ºC at 760 mmHg |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25200 |
| Flash Point | 140.9ºC |
| Exact Mass | 237.10000 |
| PSA | 64.63000 |
| LogP | 2.50470 |
| Index of Refraction | 1.546 |
| InChIKey | XUPOFTOETXEMST-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1ccc(C(=O)OCC)cc1 |
| HS Code | 2924299090 |
|---|
![N-[(Benzyloxy)carbonyl]-2-methylalanine structure](https://image.chemsrc.com/caspic/447/15030-72-5.png)
| Precursor 9 | |
|---|---|
| DownStream 1 | |
![4-[2-Oxo-5-[(2-propynyloxy)methyl]oxazolidin-3-yl]benzoic acid ethyl ester structure](https://image.chemsrc.com/caspic/244/23598-65-4.png)
CAS#:23598-65-4| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (4-Aethoxycarbonyl-phenyl)-carbamidsaeure-aethylester |
| ethyl 4-[(ethoxycarbonyl)amino]benzoate |
| 4-Carbaethoxyamino-benzoesaeure-aethylester |
| 4-Aethoxycarbonylamino-benzoesaeure-aethylester |
| 4-ethoxycarbonylamino-benzoic acid ethyl ester |
| 4-<N-(ethoxycarbonyl)amino>benzoesaure-ethylester |
| 4-Carbaethoxy-phenylurethan |