bis(2-amino-4-chlorophenyl)methanone structure
|
Common Name | bis(2-amino-4-chlorophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 5100-37-8 | Molecular Weight | 281.13700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(2-amino-4-chlorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10Cl2N2O |
|---|---|
| Molecular Weight | 281.13700 |
| Exact Mass | 280.01700 |
| PSA | 69.11000 |
| LogP | 4.55120 |
| InChIKey | ZDXUOKBMANBFMM-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)ccc1C(=O)c1ccc(Cl)cc1N |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,2'-diamino-4,4'-dichlorobenzophenone |
| 2.2'-Diamino-4.4'-dichlor-benzophenon |