2-[1-(4-chlorophenyl)-2-methyl-propan-2-yl]guanidine structure
|
Common Name | 2-[1-(4-chlorophenyl)-2-methyl-propan-2-yl]guanidine | ||
|---|---|---|---|---|
| CAS Number | 51026-12-1 | Molecular Weight | 225.71800 | |
| Density | 1.17g/cm3 | Boiling Point | 365.2ºC at 760 mmHg | |
| Molecular Formula | C11H16ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.7ºC | |
| Name | 2-[1-(4-chlorophenyl)-2-methylpropan-2-yl]guanidine |
|---|
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 365.2ºC at 760 mmHg |
| Molecular Formula | C11H16ClN3 |
| Molecular Weight | 225.71800 |
| Flash Point | 174.7ºC |
| Exact Mass | 225.10300 |
| PSA | 61.90000 |
| LogP | 3.33510 |
| Index of Refraction | 1.561 |
| InChIKey | UOHIIAODQDOEDX-UHFFFAOYSA-N |
| SMILES | CC(C)(Cc1ccc(Cl)cc1)N=C(N)N |
|
~%
2-[1-(4-chlorop... CAS#:51026-12-1 |
| Literature: Short; Ours; Ranus Jr. Journal of medicinal chemistry, 1968 , vol. 11, # 6 p. 1129 - 1135 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |