cis-Nonachlor structure
|
Common Name | cis-Nonachlor | ||
|---|---|---|---|---|
| CAS Number | 5103-73-1 | Molecular Weight | 444.224 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 451.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H5Cl9 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 229.1±24.7 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | cis-Nonachlor |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.4±40.0 °C at 760 mmHg |
| Molecular Formula | C10H5Cl9 |
| Molecular Weight | 444.224 |
| Flash Point | 229.1±24.7 °C |
| Exact Mass | 439.758789 |
| LogP | 5.90 |
| Appearance of Characters | Solid |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | OCHOKXCPKDPNQU-FLVMBEMLSA-N |
| SMILES | ClC1=C(Cl)C2(Cl)C3C(Cl)C(Cl)C(Cl)C3C1(Cl)C2(Cl)Cl |
| Storage condition | APPROX 4°C |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H400 |
| Precautionary Statements | P273 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn,N,F |
| Risk Phrases | 22-50-67-65-62-51/53-48/20-38-11-36-20/21/22 |
| Safety Phrases | 61-62-36/37-36-26-16 |
| RIDADR | UN 3077 9/PG 3 |
| RTECS | PC0970000 |
| HS Code | 2903890090 |
|
~%
cis-Nonachlor CAS#:5103-73-1 |
| Literature: Buechel,K.H. et al. Chemische Berichte, 1966 , vol. 99, p. 421 - 430 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Are exploited mangrove molluscs exposed to Persistent Organic Pollutant contamination in Senegal, West Africa?
Chemosphere 84(3) , 318-27, (2011) The surface sediments, two bivalves (Arca senilis and Crassostera gasar) and three gastropods (Conus spp., Hexaplex duplex and Pugilina morio) from two Senegalese stations, Falia (Sine-Saloum Estuary)... |
|
|
The mammalian testis accumulates lower levels of organochlorine chemicals compared with other tissues.
Reprod. Toxicol. 15(3) , 333-8, (2001) Tissues were obtained from three separate experiments in order to quantify the tissue distribution of organochlorine chemicals that are thought to be potential reproductive toxicants in males: 1) Spra... |
|
|
Selective bioaccumulation of chlorinated pesticides and metabolites in Arctic seabirds.
Environ. Pollut. 145(2) , 545-53, (2007) Chlorinated pesticides and metabolites (CPs) were quantified in the seabird species: little auk (Alle alle), Brünnich's guillemot (Uria lomvia), black guillemot (Cepphus grylle) and black-legged kitti... |
| NOB |
| 1,3,4,5,7,8,9,10,10-Nonachlorotricyclo[5.2.1.0]dec-8-ene |
| Benzene,nitroso |
| p-nitrosobenzene |
| (1a,2a,3a)-1,2,3,4,5,6,7,8,8-Nonachloro-2,3,3a,4,7,7a-hexahydro-4,7-methano-1H-indene |
| 4,7-Methano-1H-indene, 1,2,3,4,5,6,7,8,8-nonachloro-2,3,3a,4,7,7a-hexahydro- |
| 1,2,3,4,5,6,7,8,8-nonachloro-2,3,3a,4,7,7a-hexahydro-1H-4,7-methanoindene |
| keto-aniline |
| c-nonachlor |
| nitroso-benzene |
| cis nonachlor |
| ciss-nonachlor |
| C-nitrosobenzene |