4 6-DICHLORO-3-FORMYLCOUMARIN structure
|
Common Name | 4 6-DICHLORO-3-FORMYLCOUMARIN | ||
|---|---|---|---|---|
| CAS Number | 51069-87-5 | Molecular Weight | 243.04300 | |
| Density | 1.58g/cm3 | Boiling Point | 412.3ºC at 760 mmHg | |
| Molecular Formula | C10H4Cl2O3 | Melting Point | 147-151ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 188.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4,6-dichloro-2-oxochromene-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 412.3ºC at 760 mmHg |
| Melting Point | 147-151ºC(lit.) |
| Molecular Formula | C10H4Cl2O3 |
| Molecular Weight | 243.04300 |
| Flash Point | 188.6ºC |
| Exact Mass | 241.95400 |
| PSA | 47.28000 |
| LogP | 2.91230 |
| Index of Refraction | 1.631 |
| InChIKey | OKMFWQALBSVSDG-UHFFFAOYSA-N |
| SMILES | O=Cc1c(Cl)c2cc(Cl)ccc2oc1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2932209090 |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD02683797 |
| 4,6-Dichloro-3-formylcoumarin |
| 4,6-dichloro-2-oxo-2H-chromene-3-carbaldehyde |
| 4,6-Dichlor-3-formylcumarin |