WAY-325092 structure
|
Common Name | WAY-325092 | ||
|---|---|---|---|---|
| CAS Number | 510764-00-8 | Molecular Weight | 421.45 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 602.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H23N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.0±31.5 °C | |
Use of WAY-325092inhibitors of differentiation; |
| Name | WAY-325092 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 602.3±55.0 °C at 760 mmHg |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 |
| Flash Point | 318.0±31.5 °C |
| Exact Mass | 421.163757 |
| LogP | 2.84 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | YHDONQYBHDKFTG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N1CCN(Cc2ccc3c(c2)OCO3)CC1)N1C(=O)c2ccccc2C1=O |
| 1H-Isoindole-1,3(2H)-dione, 2-[2-[4-(1,3-benzodioxol-5-ylmethyl)-1-piperazinyl]-1-methyl-2-oxoethyl]- |
| 2-{1-[4-(1,3-Benzodioxol-5-ylmethyl)-1-piperazinyl]-1-oxo-2-propanyl}-1H-isoindole-1,3(2H)-dione |