Totarol structure
|
Common Name | Totarol | ||
|---|---|---|---|---|
| CAS Number | 511-15-9 | Molecular Weight | 284.479 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 346.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C20H30O | Melting Point | 128-132ºC(lit.) | |
| MSDS | N/A | Flash Point | 163.0±15.1 °C | |
Use of Totarol(+)-Totarol is a diterpenoid compound isolated from Podocarpus spp.. (+)-Totarol is a potent antioxidant and antibacterial agent[1]. |
| Name | Totarol |
|---|---|
| Synonym | More Synonyms |
| Description | (+)-Totarol is a diterpenoid compound isolated from Podocarpus spp.. (+)-Totarol is a potent antioxidant and antibacterial agent[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 346.1±37.0 °C at 760 mmHg |
| Melting Point | 128-132ºC(lit.) |
| Molecular Formula | C20H30O |
| Molecular Weight | 284.479 |
| Flash Point | 163.0±15.1 °C |
| Exact Mass | 284.250397 |
| PSA | 20.23000 |
| LogP | 8.76 |
| Vapour Pressure | 0.0±0.4 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | ZRVDANDJSTYELM-FXAWDEMLSA-N |
| SMILES | CC(C)c1c(O)ccc2c1CCC1C(C)(C)CCCC21C |
| Precursor 7 | |
|---|---|
| DownStream 3 | |
| 14-Isopropylpodocarpa-8,11,13-trien-13-ol |
| Phenanthrene, 1,2,3,4,4a,9,10,10a-octahydro-1,1,4a,7-tetramethyl-8-(1-methylethyl)-, (4aS,10aS)- |
| 4b-S-trans-8,8-trimethyl-4b,5,6,7,8,8a,9,10-octahydro-1-isopropylphenanthren-2-ol |
| 14-Isopropyl-13-methylpodocarpa-8,11,13-triene |
| 2-PHENANTHRENOL,4B,5,6,7,8,8A |
| trans-Totarol |
| 4BS TRANS,8,8-TRIMETHYL4B,5,6,7,8,8A,9,1 |
| Podocarpa-8,11,13-trien-13-ol,14-isopropyl |