3-methyl-1-oxido-1,2,4-benzotriazin-1-ium
3-methyl-1-oxido-1,2,4-benzotriazin-1-ium structure
|
Common Name | 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium | ||
|---|---|---|---|---|
| CAS Number | 51110-87-3 | Molecular Weight | 161.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-Methyl-1-oxido-1,2,4-benzotriazin-1-ium, CAS号：51110-87-3, molecular formula：C8H7N3O, molecular weight：161.16100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H7N3O |
|---|---|
| Molecular Weight | 161.16100 |
| Exact Mass | 161.05900 |
| PSA | 51.24000 |
| LogP | 1.36670 |
| InChIKey | IBNRPPRPCINGIU-UHFFFAOYSA-N |
| SMILES | Cc1nc2ccccc2[n+]([O-])n1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![2-Methyl-1H-benzo[d]imidazole structure](https://image.chemsrc.com/caspic/076/615-15-6.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 3 | |
CAS#:27446-08-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2,4-Benzotriazine,3-methyl-,1-oxide |
| 3-methyl-1,2,4-benzotriazine 1-oxide |
| 3-Methyl-5,6-benzo-1,2,4-triazin-1-oxid |
| 3-methyl-1-oxido-2H-1,2,4-benzotriazine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium? |
| A: CAS number of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium is 51110-87-3. |
| Q: What is the English name of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium? |
| A: The English name of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium is 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium. |
| Q: What English synonyms does 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium have? |
| A: English synonyms of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium: 1,2,4-Benzotriazine,3-methyl-,1-oxide, 3-methyl-1,2,4-benzotriazine 1-oxide, 3-Methyl-5,6-benzo-1,2,4-triazin-1-oxid, 3-methyl-1-oxido-2H-1,2,4-benzotriazine. |
| Q: What is the SMILES notation of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium? |
| A: SMILES notation of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium is Cc1nc2ccccc2[n+]([O-])n1. |
| Q: What is the LogP of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium? |
| A: LogP of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium is 1.36670. |
| Q: What is the polar surface area (PSA) of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium? |
| A: Polar surface area (PSA) of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium is 51.24000. |
| Q: What is the Chinese name of 51110-87-3? |
| A: Chinese name of 51110-87-3 is 51110-87-3. |
| Q: What is the InChIKey of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium? |
| A: InChIKey of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium is IBNRPPRPCINGIU-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium? |
| A: Related upstream materials(CAS) of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium: 67692-91-5;594-27-4;1528-01-4;6299-94-1;4413-30-3;71503-85-0. |
| Q: What is the molecular weight of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium? |
| A: Molecular weight of 3-methyl-1-oxido-1,2,4-benzotriazin-1-ium is 161.16100. |