[4-[(4-arsonophenyl)thiocarbamoylamino]phenyl]arsonic acid structure
|
Common Name | [4-[(4-arsonophenyl)thiocarbamoylamino]phenyl]arsonic acid | ||
|---|---|---|---|---|
| CAS Number | 51112-57-3 | Molecular Weight | 476.16800 | |
| Density | N/A | Boiling Point | 793.5ºC at 760 mmHg | |
| Molecular Formula | C13H14As2N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 433.7ºC | |
| Name | [4-[(4-arsonophenyl)carbamothioylamino]phenyl]arsonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 793.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H14As2N2O6S |
| Molecular Weight | 476.16800 |
| Flash Point | 433.7ºC |
| Exact Mass | 475.90000 |
| PSA | 171.21000 |
| InChIKey | MGANBGWBZJFKAL-UHFFFAOYSA-N |
| SMILES | O=[As](O)(O)c1ccc(NC(=S)Nc2ccc([As](=O)(O)O)cc2)cc1 |
|
~%
[4-[(4-arsonoph... CAS#:51112-57-3 |
| Literature: Everett Journal of the Chemical Society, 1929 , p. 677 |
|
~%
[4-[(4-arsonoph... CAS#:51112-57-3 |
| Literature: Everett Journal of the Chemical Society, 1930 , p. 1691,1694,1698 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N.N'-Thiocarbonyl-diarsanilsaeure |