2-(4-BROMO-3-OXOBUTYL)ISOINDOLINE-1,3-DIONE structure
|
Common Name | 2-(4-BROMO-3-OXOBUTYL)ISOINDOLINE-1,3-DIONE | ||
|---|---|---|---|---|
| CAS Number | 51132-00-4 | Molecular Weight | 296.11700 | |
| Density | 1.614g/cm3 | Boiling Point | 427.3ºC at 760 mmHg | |
| Molecular Formula | C12H10BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.2ºC | |
| Name | 2-(4-bromo-3-oxobutyl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.614g/cm3 |
|---|---|
| Boiling Point | 427.3ºC at 760 mmHg |
| Molecular Formula | C12H10BrNO3 |
| Molecular Weight | 296.11700 |
| Flash Point | 212.2ºC |
| Exact Mass | 294.98400 |
| PSA | 54.45000 |
| LogP | 1.57460 |
| Index of Refraction | 1.614 |
| InChIKey | PTPZBCHKQSHXQZ-UHFFFAOYSA-N |
| SMILES | O=C(CBr)CCN1C(=O)c2ccccc2C1=O |
| HS Code | 2925290090 |
|---|
| Precursor 6 | |
|---|---|
| DownStream 4 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-(4-BROMO-3-OXOBUTYL)-1H-ISOINDOLE-1,3(2H)-DIONE |
| 2-(4-bromo-3-oxobutyl)-1,3-dihydro-2H-isoindole-1,3-dione |
| 2-(4-bromo-3-oxobutyl)benzo[c]azolidine-1,3-dione |
| 1-bromo-4-phthalimido-2-butanone |
| 1-Bromo-4-phthalimidobutan-2-one |
| 2-(4-Bromo-3-oxobutyl)isoindoline-1,3-dione |
| 1-Bromo-4-N-phthalimido-2-butanone |
| 2-(4-bromo-3-oxo-butyl)-isoindole-1,3-dione |
| F3284-8017 |