2-(4-BROMO-3-OXOBUTYL)ISOINDOLINE-1,3-DIONE
Modify Date: 2025-10-12 14:59:23
2-(4-BROMO-3-OXOBUTYL)ISOINDOLINE-1,3-DIONE structure
|
Common Name | 2-(4-BROMO-3-OXOBUTYL)ISOINDOLINE-1,3-DIONE | ||
|---|---|---|---|---|
| CAS Number | 51132-00-4 | Molecular Weight | 296.11700 | |
| Density | 1.614g/cm3 | Boiling Point | 427.3ºC at 760 mmHg | |
| Molecular Formula | C12H10BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.2ºC | |
| Name | 2-(4-bromo-3-oxobutyl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.614g/cm3 |
|---|---|
| Boiling Point | 427.3ºC at 760 mmHg |
| Molecular Formula | C12H10BrNO3 |
| Molecular Weight | 296.11700 |
| Flash Point | 212.2ºC |
| Exact Mass | 294.98400 |
| PSA | 54.45000 |
| LogP | 1.57460 |
| Index of Refraction | 1.614 |
| InChIKey | PTPZBCHKQSHXQZ-UHFFFAOYSA-N |
| SMILES | O=C(CBr)CCN1C(=O)c2ccccc2C1=O |
| HS Code | 2925290090 |
|---|
| Precursor 6 | |
|---|---|
| DownStream 4 | |
CAS#:3783-77-5![[4-(1,3-dioxoisoindol-2-yl)-2-oxo-butylidene]-imino-azanium Structure](https://image.chemsrc.com/caspic/469/7504-49-6.png)
CAS#:7504-49-6
CAS#:186581-53-3
CAS#:3339-73-9
CAS#:85-44-9
CAS#:17137-11-0![2-[2-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione,hydrochloride structure](https://image.chemsrc.com/caspic/153/137118-00-4.png)
CAS#:137118-00-4![[4-(1,3-dioxoisoindol-2-yl)-2-oxobutyl] acetate structure](https://image.chemsrc.com/caspic/025/65465-66-9.png)
CAS#:65465-66-9![2-[2-(2-AMINO-1,3-THIAZOL-4-YL)ETHYL]-1H-ISOINDOLE-1,3(2H)-DIONE HYDROBROMIDE structure](https://image.chemsrc.com/caspic/464/95914-09-3.png)
CAS#:95914-09-3![2-(2-imidazo[1,2-a]pyridin-2-ylethyl)isoindole-1,3-dione structure](https://image.chemsrc.com/caspic/326/51132-01-5.png)
CAS#:51132-01-5| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
Total 3, Current Page 1 of 1
1
| 2-(4-BROMO-3-OXOBUTYL)-1H-ISOINDOLE-1,3(2H)-DIONE |
| 2-(4-bromo-3-oxobutyl)-1,3-dihydro-2H-isoindole-1,3-dione |
| 2-(4-bromo-3-oxobutyl)benzo[c]azolidine-1,3-dione |
| 1-bromo-4-phthalimido-2-butanone |
| 1-Bromo-4-phthalimidobutan-2-one |
| 2-(4-Bromo-3-oxobutyl)isoindoline-1,3-dione |
| 1-Bromo-4-N-phthalimido-2-butanone |
| 2-(4-bromo-3-oxo-butyl)-isoindole-1,3-dione |
| F3284-8017 |