2-(2-imidazo[1,2-a]pyridin-2-ylethyl)isoindole-1,3-dione structure
|
Common Name | 2-(2-imidazo[1,2-a]pyridin-2-ylethyl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 51132-01-5 | Molecular Weight | 291.30400 | |
| Density | 1.36g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-imidazo[1,2-a]pyridin-2-ylethyl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.30400 |
| Exact Mass | 291.10100 |
| PSA | 54.68000 |
| LogP | 2.11090 |
| Index of Refraction | 1.711 |
| InChIKey | AKDOVKWGFPLJDK-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CCc1cn2ccccc2n1 |
|
~%
2-(2-imidazo[1,... CAS#:51132-01-5 |
| Literature: Smith Kline and French Laboratories Limited Patent: US3970753 A1, 1976 ; US 3970753 A |
|
~64%
2-(2-imidazo[1,... CAS#:51132-01-5 |
| Literature: Talbot, Eric P. A.; Richardson, Melodie; McKenna, Jeffrey M.; Toste, F. Dean Advanced Synthesis and Catalysis, 2014 , vol. 356, # 4 p. 687 - 691 |
| f2184-0181 |