1,2-Ethylenebisdecanamide structure
|
Common Name | 1,2-Ethylenebisdecanamide | ||
|---|---|---|---|---|
| CAS Number | 51139-08-3 | Molecular Weight | 368.59700 | |
| Density | 0.913g/cm3 | Boiling Point | 562.8ºC at 760 mmHg | |
| Molecular Formula | C22H44N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.6ºC | |
| Name | 1,2-Ethylenebisdecanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.913g/cm3 |
|---|---|
| Boiling Point | 562.8ºC at 760 mmHg |
| Molecular Formula | C22H44N2O2 |
| Molecular Weight | 368.59700 |
| Flash Point | 152.6ºC |
| Exact Mass | 368.34000 |
| PSA | 58.20000 |
| LogP | 6.28200 |
| Index of Refraction | 1.463 |
| InChIKey | KYMPOPAPQCIHEG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)NCCNC(=O)CCCCCCCCC |
| HS Code | 2924199090 |
|---|
|
~%
1,2-Ethylenebis... CAS#:51139-08-3 |
| Literature: Takase Nippon Kagaku Zasshi, 1948 , vol. 69, p. 154,156 Chem.Abstr., 1952 , p. 3951 |
|
~%
1,2-Ethylenebis... CAS#:51139-08-3 |
| Literature: Butler, Richard N.; Thornton, John D.; O'Regan, C.B. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2197 - 2200 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-Aethandiyl-bis-decanamid |
| Caprinsaeure-ethylendiamid |
| ethylene bisdecanamide |
| N,N'-Dicaprinoylethylendiamin |
| N,N'-ethanediyl-bis-decanamide |