(2-nitrophenyl)methanesulfonamide structure
|
Common Name | (2-nitrophenyl)methanesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 51145-00-7 | Molecular Weight | 216.21400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H8N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-nitrophenyl)methanesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H8N2O4S |
|---|---|
| Molecular Weight | 216.21400 |
| Exact Mass | 216.02000 |
| PSA | 114.36000 |
| LogP | 2.68760 |
| InChIKey | SNCFSWRNEADGAI-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)Cc1ccccc1[N+](=O)[O-] |
|
~99%
(2-nitrophenyl)... CAS#:51145-00-7 |
| Literature: ASTRAZENECA AB Patent: WO2007/8140 A1, 2007 ; Location in patent: Page/Page column 81; 82 ; WO 2007/008140 A1 |
|
~%
(2-nitrophenyl)... CAS#:51145-00-7 |
| Literature: Ingold; Ingold; Shaw Journal of the Chemical Society, 1927 , p. 818 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| nitrobenzylsulphonamide |
| 2-nitrophenylmethanesulfonamide |
| 2-nitrobenzylsulfonamide |
| Benzenemethanesulfonamide,2-nitro |