2-nitro-alpha-toluenesulfonyl chloride structure
|
Common Name | 2-nitro-alpha-toluenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 24974-75-2 | Molecular Weight | 235.64500 | |
| Density | 1.57g/cm3 | Boiling Point | 367.5ºC at 760 mmHg | |
| Molecular Formula | C7H6ClNO4S | Melting Point | 64-66ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 176.1ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | (2-nitrophenyl)methanesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 367.5ºC at 760 mmHg |
| Melting Point | 64-66ºC(lit.) |
| Molecular Formula | C7H6ClNO4S |
| Molecular Weight | 235.64500 |
| Flash Point | 176.1ºC |
| Exact Mass | 234.97100 |
| PSA | 88.34000 |
| LogP | 3.26740 |
| Vapour Pressure | 2.87E-05mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | FUEFNUGYRWQHTH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1CS(=O)(=O)Cl |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| HS Code | 2904909090 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Synthesis and biological properties of novel pyridinioalkanoyl thiolesters (PATE) as anti-HIV-1 agents that target the viral nucleocapsid protein zinc fingers.
J. Med. Chem. 42(1) , 67-86, (1999) Nucleocapsid p7 protein (NCp7) zinc finger domains of the human immunodeficiency virus type 1 (HIV-1) are being developed as antiviral targets due to their key roles in viral replication and their mut... |
| 2-Nitro-|A-toluenesulfonyl chloride |
| (2-nitrophenyl)methanesulphonyl chloride |
| (2-nitrophenyl)-methanesulfonyl chloride |
| 2-nitrobenzylsulphonyl chloride |
| MFCD00082526 |