2-nitro-alpha-toluenesulfonyl chloride
2-nitro-alpha-toluenesulfonyl chloride structure
|
Common Name | 2-nitro-alpha-toluenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 24974-75-2 | Molecular Weight | 235.64500 | |
| Density | 1.57g/cm3 | Boiling Point | 367.5ºC at 760 mmHg | |
| Molecular Formula | C7H6ClNO4S | Melting Point | 64-66ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 176.1ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-nitrophenyl)methanesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 367.5ºC at 760 mmHg |
| Melting Point | 64-66ºC(lit.) |
| Molecular Formula | C7H6ClNO4S |
| Molecular Weight | 235.64500 |
| Flash Point | 176.1ºC |
| Exact Mass | 234.97100 |
| PSA | 88.34000 |
| LogP | 3.26740 |
| Vapour Pressure | 2.87E-05mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | FUEFNUGYRWQHTH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1CS(=O)(=O)Cl |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| HS Code | 2904909090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:612-23-7![1,3-dihydrobenzo[c]isothiazole 2,2-dioxide structure](https://image.chemsrc.com/caspic/114/111248-89-6.png)
CAS#:111248-89-6
CAS#:51145-00-7This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table lists relevant public references with title, journal and publication metadata for this compound.
|
Synthesis and biological properties of novel pyridinioalkanoyl thiolesters (PATE) as anti-HIV-1 agents that target the viral nucleocapsid protein zinc fingers.
J. Med. Chem. 42(1) , 67-86, (1999) Nucleocapsid p7 protein (NCp7) zinc finger domains of the human immunodeficiency virus type 1 (HIV-1) are being developed as antiviral targets due to their key roles in viral replication and their mut... |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Nitro-|A-toluenesulfonyl chloride |
| (2-nitrophenyl)methanesulphonyl chloride |
| (2-nitrophenyl)-methanesulfonyl chloride |
| 2-nitrobenzylsulphonyl chloride |
| MFCD00082526 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of (2-nitrophenyl)methanesulfonyl chloride? |
| A: Related downstream products(CAS) of (2-nitrophenyl)methanesulfonyl chloride: 612-23-7;111248-89-6;51145-00-7. |
| Q: What is the molecular formula of (2-nitrophenyl)methanesulfonyl chloride? |
| A: Molecular formula of (2-nitrophenyl)methanesulfonyl chloride is C7H6ClNO4S. |
| Q: What is the InChIKey of (2-nitrophenyl)methanesulfonyl chloride? |
| A: InChIKey of (2-nitrophenyl)methanesulfonyl chloride is FUEFNUGYRWQHTH-UHFFFAOYSA-N. |
| Q: What is the LogP of (2-nitrophenyl)methanesulfonyl chloride? |
| A: LogP of (2-nitrophenyl)methanesulfonyl chloride is 3.26740. |
| Q: What is the safety information for (2-nitrophenyl)methanesulfonyl chloride? |
| A: Safety information for (2-nitrophenyl)methanesulfonyl chloride: 26-36/37/39-45. |
| Q: What English synonyms does (2-nitrophenyl)methanesulfonyl chloride have? |
| A: English synonyms of (2-nitrophenyl)methanesulfonyl chloride: 2-Nitro-|A-toluenesulfonyl chloride, (2-nitrophenyl)methanesulphonyl chloride, (2-nitrophenyl)-methanesulfonyl chloride, 2-nitrobenzylsulphonyl chloride, MFCD00082526. |
| Q: What is the polar surface area (PSA) of (2-nitrophenyl)methanesulfonyl chloride? |
| A: Polar surface area (PSA) of (2-nitrophenyl)methanesulfonyl chloride is 88.34000. |
| Q: What is the melting point of (2-nitrophenyl)methanesulfonyl chloride? |
| A: Melting point of (2-nitrophenyl)methanesulfonyl chloride is 64-66ºC(lit.). |
| Q: What is the SMILES notation of (2-nitrophenyl)methanesulfonyl chloride? |
| A: SMILES notation of (2-nitrophenyl)methanesulfonyl chloride is O=[N+]([O-])c1ccccc1CS(=O)(=O)Cl. |
| Q: What is the English name of (2-nitrophenyl)methanesulfonyl chloride? |
| A: The English name of (2-nitrophenyl)methanesulfonyl chloride is (2-nitrophenyl)methanesulfonyl chloride. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |