N-(4-Acetylphenyl)-2-methylbenzamide structure
|
Common Name | N-(4-Acetylphenyl)-2-methylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 5116-70-1 | Molecular Weight | 253.29600 | |
| Density | 1.172g/cm3 | Boiling Point | 352.2ºC at 760 mmHg | |
| Molecular Formula | C16H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.7ºC | |
| Name | N-(4-Acetylphenyl)-2-methylbenzamide |
|---|
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 352.2ºC at 760 mmHg |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.29600 |
| Flash Point | 123.7ºC |
| Exact Mass | 253.11000 |
| PSA | 46.17000 |
| LogP | 3.52290 |
| Index of Refraction | 1.617 |
| InChIKey | IYIKQSKTEPKKFM-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccccc2C)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |